C12H16N4O3 — CID 106409760
2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 106409760) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 106409760 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | O=C1C2CCCN2C(=O)CCN1CCc1ncon1 |
| InChI | InChI=1S/C12H16N4O3/c17-11-4-7-15(6-3-10-13-8-19-14-10)12(18)9-2-1-5-16(9)11/h8-9H,1-7H2 |
| InChIKey | IALUBXNCHJIFEA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |