C11H13Cl2N5O — CID 106378952
3,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridin-2-amine (PubChem CID 106378952) has the molecular formula C11H13Cl2N5O and a molecular weight of 302.17 g/mol. Its IUPAC name is 3,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 106378952 |
| Molecular Formula | C11H13Cl2N5O |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridin-2-amine |
| SMILES | CCc1cnc(CNc2nc(NN)c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C11H13Cl2N5O/c1-2-6-4-15-9(19-6)5-16-10-7(12)3-8(13)11(17-10)18-14/h3-4H,2,5,14H2,1H3,(H2,16,17,18) |
| InChIKey | ACYWZNBUOSQDHJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|