C11H18N8O — CID 106378957
2-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 106378957) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106378957 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1cnc(CNc2nc(NN)nc(N(C)C)n2)o1 |
| InChI | InChI=1S/C11H18N8O/c1-4-7-5-13-8(20-7)6-14-9-15-10(18-12)17-11(16-9)19(2)3/h5H,4,6,12H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | DBBDGKRMHNITAS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|