C12H18N8 — CID 114958025
6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-3-pyridinyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 114958025) has the molecular formula C12H18N8 and a molecular weight of 274.33 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-3-pyridinyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-3-pyridinyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 114958025 |
| Molecular Formula | C12H18N8 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-3-pyridinyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccncc1CNc1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H18N8/c1-8-4-5-14-6-9(8)7-15-10-16-11(19-13)18-12(17-10)20(2)3/h4-6H,7,13H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | WFRICKQOBOTFQD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|