C10H11F2N5O — CID 106379001
3,5-difluoro-6-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]pyridin-2-amine (PubChem CID 106379001) has the molecular formula C10H11F2N5O and a molecular weight of 255.23 g/mol. Its IUPAC name is 3,5-difluoro-6-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]pyridin-2-amine.
| Compound Name | 3,5-difluoro-6-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106379001 |
| Molecular Formula | C10H11F2N5O |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3,5-difluoro-6-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]pyridin-2-amine |
| SMILES | Cc1cnc(CNc2nc(NN)c(F)cc2F)o1 |
| InChI | InChI=1S/C10H11F2N5O/c1-5-3-14-8(18-5)4-15-9-6(11)2-7(12)10(16-9)17-13/h2-3H,4,13H2,1H3,(H2,15,16,17) |
| InChIKey | GTWWFUTXCRWXGW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|