C8H14N2O3S — CID 106379763
4-[(2,2-dimethoxyethylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379763) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-[(2,2-dimethoxyethylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2,2-dimethoxyethylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379763 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-[(2,2-dimethoxyethylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COC(CNCc1csc(=O)[nH]1)OC |
| InChI | InChI=1S/C8H14N2O3S/c1-12-7(13-2)4-9-3-6-5-14-8(11)10-6/h5,7,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | ZWJRYTLZYIIGLH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|