C10H16N2O2S — CID 106379867
4-[[(3-ethoxycyclobutyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379867) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-[[(3-ethoxycyclobutyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(3-ethoxycyclobutyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379867 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[[(3-ethoxycyclobutyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCOC1CC(NCc2csc(=O)[nH]2)C1 |
| InChI | InChI=1S/C10H16N2O2S/c1-2-14-9-3-7(4-9)11-5-8-6-15-10(13)12-8/h6-7,9,11H,2-5H2,1H3,(H,12,13) |
| InChIKey | SJYCNVSSMOOYJE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |