C10H18N2O2S — CID 106379634
4-[[(3-methoxy-3-methylbutyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379634) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 4-[[(3-methoxy-3-methylbutyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(3-methoxy-3-methylbutyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379634 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-[[(3-methoxy-3-methylbutyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | COC(C)(C)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H18N2O2S/c1-10(2,14-3)4-5-11-6-8-7-15-9(13)12-8/h7,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | FTVBICZUSRPEGE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|