C12H20N2O2S — CID 106380527
4-[[(2-propyloxan-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380527) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-[[(2-propyloxan-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-propyloxan-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380527 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-[[(2-propyloxan-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCC1CC(NCc2csc(=O)[nH]2)CCO1 |
| InChI | InChI=1S/C12H20N2O2S/c1-2-3-11-6-9(4-5-16-11)13-7-10-8-17-12(15)14-10/h8-9,11,13H,2-7H2,1H3,(H,14,15) |
| InChIKey | PUUCDLZMHIEPKG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |