C11H18N2O2S — CID 106379723
4-[[(2-methoxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379723) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-[[(2-methoxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-methoxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379723 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-[[(2-methoxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | COC1CCCCC1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H18N2O2S/c1-15-10-5-3-2-4-9(10)12-6-8-7-16-11(14)13-8/h7,9-10,12H,2-6H2,1H3,(H,13,14) |
| InChIKey | RNOBPICPEZLVFV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |