C7H12N2O2S — CID 106380675
4-[(2-hydroxypropylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380675) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 4-[(2-hydroxypropylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-hydroxypropylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380675 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4-[(2-hydroxypropylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H12N2O2S/c1-5(10)2-8-3-6-4-12-7(11)9-6/h4-5,8,10H,2-3H2,1H3,(H,9,11) |
| InChIKey | USPFWAHDBHYGHZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |