C9H13N3OS — CID 106380676
5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentanenitrile (PubChem CID 106380676) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentanenitrile.
| Compound Name | 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 106380676 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentanenitrile |
| SMILES | N#CCCCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3OS/c10-4-2-1-3-5-11-6-8-7-14-9(13)12-8/h7,11H,1-3,5-6H2,(H,12,13) |
| InChIKey | GSYBQRMSYIDEJB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|