C7H12N2O3S — CID 106380712
4-[(2,3-dihydroxypropylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380712) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 4-[(2,3-dihydroxypropylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2,3-dihydroxypropylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380712 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-[(2,3-dihydroxypropylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCC(O)CO)cs1 |
| InChI | InChI=1S/C7H12N2O3S/c10-3-6(11)2-8-1-5-4-13-7(12)9-5/h4,6,8,10-11H,1-3H2,(H,9,12) |
| InChIKey | DQELRDKHXKLFMG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |