C12H19N3OS — CID 106380764
2,2-dimethyl-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]hexanenitrile (PubChem CID 106380764) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]hexanenitrile |
|---|---|
| PubChem CID | 106380764 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2,2-dimethyl-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]hexanenitrile |
| SMILES | CC(C)(C#N)CCCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C12H19N3OS/c1-12(2,9-13)5-3-4-6-14-7-10-8-17-11(16)15-10/h8,14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | RJFHPFJFXBQLMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|