C9H14N2O3S — CID 106380796
methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate (PubChem CID 106380796) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate.
| Compound Name | methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 106380796 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O3S/c1-14-8(12)3-2-4-10-5-7-6-15-9(13)11-7/h6,10H,2-5H2,1H3,(H,11,13) |
| InChIKey | QALMZGNPFXWDTF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|