C8H12N2O3S — CID 106380908
3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoic acid (PubChem CID 106380908) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoic acid.
| Compound Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 106380908 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O3S/c1-5(2-7(11)12)9-3-6-4-14-8(13)10-6/h4-5,9H,2-3H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | CJXWODGFSBLRPD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |