C8H14N2O3S — CID 106380915
4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380915) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380915 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCOCCO)cs1 |
| InChI | InChI=1S/C8H14N2O3S/c11-2-4-13-3-1-9-5-7-6-14-8(12)10-7/h6,9,11H,1-5H2,(H,10,12) |
| InChIKey | PBGXNHNXXBJYHF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|