C8H13N3O2S — CID 106380943
N-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide (PubChem CID 106380943) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is N-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide.
| Compound Name | N-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 106380943 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-methyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide |
| SMILES | CNC(=O)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O2S/c1-9-7(12)2-3-10-4-6-5-14-8(13)11-6/h5,10H,2-4H2,1H3,(H,9,12)(H,11,13) |
| InChIKey | VEIKOSDUVZFWJE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|