C10H16N2O2S — CID 106381032
4-[[(2-hydroxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381032) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-[[(2-hydroxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-hydroxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381032 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[[(2-hydroxycyclohexyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNC2CCCCC2O)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c13-9-4-2-1-3-8(9)11-5-7-6-15-10(14)12-7/h6,8-9,11,13H,1-5H2,(H,12,14) |
| InChIKey | WGAARZODKIRGBW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |