C8H14N2O2S — CID 106381135
4-[(2-methoxypropylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381135) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 4-[(2-methoxypropylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-methoxypropylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381135 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-[(2-methoxypropylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COC(C)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H14N2O2S/c1-6(12-2)3-9-4-7-5-13-8(11)10-7/h5-6,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | CJNIYNCENGQVRM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |