C16H21N3OS — CID 106383617
4-[(3-methyl-3-phenyl-1,4-diazepan-1-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106383617) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[(3-methyl-3-phenyl-1,4-diazepan-1-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3-methyl-3-phenyl-1,4-diazepan-1-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106383617 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[(3-methyl-3-phenyl-1,4-diazepan-1-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC1(c2ccccc2)CN(Cc2csc(=O)[nH]2)CCCN1 |
| InChI | InChI=1S/C16H21N3OS/c1-16(13-6-3-2-4-7-13)12-19(9-5-8-17-16)10-14-11-21-15(20)18-14/h2-4,6-7,11,17H,5,8-10,12H2,1H3,(H,18,20) |
| InChIKey | OAXGTCZYICUYHP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |