C15H19N3S — CID 112644804
5-[(3-methyl-3-phenylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 112644804) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-[(3-methyl-3-phenylpiperazin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(3-methyl-3-phenylpiperazin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112644804 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-[(3-methyl-3-phenylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CC1(c2ccccc2)CN(Cc2cncs2)CCN1 |
| InChI | InChI=1S/C15H19N3S/c1-15(13-5-3-2-4-6-13)11-18(8-7-17-15)10-14-9-16-12-19-14/h2-6,9,12,17H,7-8,10-11H2,1H3 |
| InChIKey | JFZLHYUMHKZIOV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |