C11H16N4O2S — CID 106384025
4-[[5-[(2-methoxyethylamino)methyl]imidazol-1-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384025) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-[[5-[(2-methoxyethylamino)methyl]imidazol-1-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[5-[(2-methoxyethylamino)methyl]imidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384025 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[[5-[(2-methoxyethylamino)methyl]imidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | COCCNCc1cncn1Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H16N4O2S/c1-17-3-2-12-4-10-5-13-8-15(10)6-9-7-18-11(16)14-9/h5,7-8,12H,2-4,6H2,1H3,(H,14,16) |
| InChIKey | OVBLFAOMGPTFNE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|