C17H32N4O3S2 — CID 155934069
2-(2-aminoethoxy)ethyl 4-[[bis(2-ethylsulfanylethyl)amino]methyl]imidazole-1-carboxylate (PubChem CID 155934069) has the molecular formula C17H32N4O3S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 4-[[bis(2-ethylsulfanylethyl)amino]methyl]imidazole-1-carboxylate.
| Compound Name | 2-(2-aminoethoxy)ethyl 4-[[bis(2-ethylsulfanylethyl)amino]methyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 155934069 |
| Molecular Formula | C17H32N4O3S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 4-[[bis(2-ethylsulfanylethyl)amino]methyl]imidazole-1-carboxylate |
| SMILES | CCSCCN(CCSCC)Cc1cn(C(=O)OCCOCCN)cn1 |
| InChI | InChI=1S/C17H32N4O3S2/c1-3-25-11-6-20(7-12-26-4-2)13-16-14-21(15-19-16)17(22)24-10-9-23-8-5-18/h14-15H,3-13,18H2,1-2H3 |
| InChIKey | UBJIYPUHQJCOBN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|