C16H25N7O4S — CID 142842175
2-[[4-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethylsulfanylmethyl]imidazole-1-carbonyl]-methylamino]ethyl ethyl carbonate (PubChem CID 142842175) has the molecular formula C16H25N7O4S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-[[4-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethylsulfanylmethyl]imidazole-1-carbonyl]-methylamino]ethyl ethyl carbonate.
| Compound Name | 2-[[4-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethylsulfanylmethyl]imidazole-1-carbonyl]-methylamino]ethyl ethyl carbonate |
|---|---|
| PubChem CID | 142842175 |
| Molecular Formula | C16H25N7O4S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[4-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethylsulfanylmethyl]imidazole-1-carbonyl]-methylamino]ethyl ethyl carbonate |
| SMILES | CCOC(=O)OCCN(C)C(=O)n1cnc(CSCCN/C(=N/C)NC#N)c1 |
| InChI | InChI=1S/C16H25N7O4S/c1-4-26-16(25)27-7-6-22(3)15(24)23-9-13(21-12-23)10-28-8-5-19-14(18-2)20-11-17/h9,12H,4-8,10H2,1-3H3,(H2,18,19,20) |
| InChIKey | UYOWJDXAWLMVET-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|