C12H23N3OS — CID 106573660
N-(1-methoxypropan-2-yl)-4-methyl-1-(3-methylsulfanylpropyl)imidazol-2-amine (PubChem CID 106573660) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-4-methyl-1-(3-methylsulfanylpropyl)imidazol-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-4-methyl-1-(3-methylsulfanylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106573660 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-4-methyl-1-(3-methylsulfanylpropyl)imidazol-2-amine |
| SMILES | COCC(C)Nc1nc(C)cn1CCCSC |
| InChI | InChI=1S/C12H23N3OS/c1-10-8-15(6-5-7-17-4)12(13-10)14-11(2)9-16-3/h8,11H,5-7,9H2,1-4H3,(H,13,14) |
| InChIKey | GOEIQAXSLQVHJY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|