C10H11N9OS — CID 106384082
4-[[[4-(methylamino)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384082) has the molecular formula C10H11N9OS and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[[[4-(methylamino)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[[4-(methylamino)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384082 |
| Molecular Formula | C10H11N9OS |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[[[4-(methylamino)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CNc1nc(NCc2csc(=O)[nH]2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H11N9OS/c1-11-7-16-8(13-2-6-3-21-10(20)15-6)18-9(17-7)19-5-12-4-14-19/h3-5H,2H2,1H3,(H,15,20)(H2,11,13,16,17,18) |
| InChIKey | NFWKGPAPBVGHRQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |