C10H14F2N2O2 — CID 106385366
3-(2,2-difluoroethoxy)-N-(1H-pyrrol-3-ylmethyl)propanamide (PubChem CID 106385366) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(1H-pyrrol-3-ylmethyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(1H-pyrrol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106385366 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(1H-pyrrol-3-ylmethyl)propanamide |
| SMILES | O=C(CCOCC(F)F)NCc1cc[nH]c1 |
| InChI | InChI=1S/C10H14F2N2O2/c11-9(12)7-16-4-2-10(15)14-6-8-1-3-13-5-8/h1,3,5,9,13H,2,4,6-7H2,(H,14,15) |
| InChIKey | SLCRVHDZFFHDTD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|