C9H14N2O2 — CID 106385639
3-methoxy-N-(1H-pyrrol-3-ylmethyl)propanamide (PubChem CID 106385639) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-methoxy-N-(1H-pyrrol-3-ylmethyl)propanamide.
| Compound Name | 3-methoxy-N-(1H-pyrrol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106385639 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-methoxy-N-(1H-pyrrol-3-ylmethyl)propanamide |
| SMILES | COCCC(=O)NCc1cc[nH]c1 |
| InChI | InChI=1S/C9H14N2O2/c1-13-5-3-9(12)11-7-8-2-4-10-6-8/h2,4,6,10H,3,5,7H2,1H3,(H,11,12) |
| InChIKey | IBHLAWXWYKWXIC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |