C11H19N3O2 — CID 115686119
N-(2-methoxyethyl)-3-(1H-pyrrol-3-ylmethylamino)propanamide (PubChem CID 115686119) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(1H-pyrrol-3-ylmethylamino)propanamide.
| Compound Name | N-(2-methoxyethyl)-3-(1H-pyrrol-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 115686119 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(2-methoxyethyl)-3-(1H-pyrrol-3-ylmethylamino)propanamide |
| SMILES | COCCNC(=O)CCNCc1cc[nH]c1 |
| InChI | InChI=1S/C11H19N3O2/c1-16-7-6-14-11(15)3-5-13-9-10-2-4-12-8-10/h2,4,8,12-13H,3,5-7,9H2,1H3,(H,14,15) |
| InChIKey | VTPUUUMSZPXBFC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|