C13H24N4O2 — CID 114556095
N-(2-methoxyethyl)-3-[(2-propylpyrazol-3-yl)methylamino]propanamide (PubChem CID 114556095) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(2-propylpyrazol-3-yl)methylamino]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[(2-propylpyrazol-3-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 114556095 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(2-propylpyrazol-3-yl)methylamino]propanamide |
| SMILES | CCCn1nccc1CNCCC(=O)NCCOC |
| InChI | InChI=1S/C13H24N4O2/c1-3-9-17-12(4-7-16-17)11-14-6-5-13(18)15-8-10-19-2/h4,7,14H,3,5-6,8-11H2,1-2H3,(H,15,18) |
| InChIKey | SITYFBNFQFIYFS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|