C11H8Cl3N3O — CID 106385570
3,4,5-trichloro-N-(1H-pyrrol-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 106385570) has the molecular formula C11H8Cl3N3O and a molecular weight of 304.56 g/mol. Its IUPAC name is 3,4,5-trichloro-N-(1H-pyrrol-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 3,4,5-trichloro-N-(1H-pyrrol-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106385570 |
| Molecular Formula | C11H8Cl3N3O |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3,4,5-trichloro-N-(1H-pyrrol-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1cc[nH]c1)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl3N3O/c12-7-5-16-10(9(14)8(7)13)11(18)17-4-6-1-2-15-3-6/h1-3,5,15H,4H2,(H,17,18) |
| InChIKey | KIGFATFTQSHFQH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |