C12H9Cl2FN2O — CID 114182114
2,4-dichloro-5-fluoro-N-(1H-pyrrol-3-ylmethyl)benzamide (PubChem CID 114182114) has the molecular formula C12H9Cl2FN2O and a molecular weight of 287.12 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(1H-pyrrol-3-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(1H-pyrrol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 114182114 |
| Molecular Formula | C12H9Cl2FN2O |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(1H-pyrrol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cc[nH]c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2FN2O/c13-9-4-10(14)11(15)3-8(9)12(18)17-6-7-1-2-16-5-7/h1-5,16H,6H2,(H,17,18) |
| InChIKey | VPJKFBIBQJWOFA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|