C12H9F2N3O3 — CID 106384628
4,5-difluoro-2-nitro-N-(1H-pyrrol-3-ylmethyl)benzamide (PubChem CID 106384628) has the molecular formula C12H9F2N3O3 and a molecular weight of 281.22 g/mol. Its IUPAC name is 4,5-difluoro-2-nitro-N-(1H-pyrrol-3-ylmethyl)benzamide.
| Compound Name | 4,5-difluoro-2-nitro-N-(1H-pyrrol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106384628 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4,5-difluoro-2-nitro-N-(1H-pyrrol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cc[nH]c1)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9F2N3O3/c13-9-3-8(11(17(19)20)4-10(9)14)12(18)16-6-7-1-2-15-5-7/h1-5,15H,6H2,(H,16,18) |
| InChIKey | VWPAKDSGJDRKLA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|