C14H19N5 — CID 106387163
4-[5-(2,3-dihydro-1H-inden-2-yl)tetrazol-1-yl]butan-1-amine (PubChem CID 106387163) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1H-inden-2-yl)tetrazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-(2,3-dihydro-1H-inden-2-yl)tetrazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 106387163 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-[5-(2,3-dihydro-1H-inden-2-yl)tetrazol-1-yl]butan-1-amine |
| SMILES | NCCCCn1nnnc1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H19N5/c15-7-3-4-8-19-14(16-17-18-19)13-9-11-5-1-2-6-12(11)10-13/h1-2,5-6,13H,3-4,7-10,15H2 |
| InChIKey | DRTWTJXBSCZDDA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|