C12H15N3O — CID 106387648
2-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 106387648) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106387648 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Cc1cnc(C(C)Nc2ccccc2N)o1 |
| InChI | InChI=1S/C12H15N3O/c1-8-7-14-12(16-8)9(2)15-11-6-4-3-5-10(11)13/h3-7,9,15H,13H2,1-2H3 |
| InChIKey | JBYPQAATQGQMBC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|