C12H14BrN3O — CID 106387609
4-bromo-1-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 106387609) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 4-bromo-1-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106387609 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-bromo-1-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Cc1cnc(C(C)Nc2ccc(Br)cc2N)o1 |
| InChI | InChI=1S/C12H14BrN3O/c1-7-6-15-12(17-7)8(2)16-11-4-3-9(13)5-10(11)14/h3-6,8,16H,14H2,1-2H3 |
| InChIKey | SQOUEBVJRLGDJH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|