C13H14ClN3OS — CID 106388558
3-chloro-4-[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]benzenecarbothioamide (PubChem CID 106388558) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 3-chloro-4-[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106388558 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-chloro-4-[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1cnc(C(C)Nc2ccc(C(N)=S)cc2Cl)o1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-7-6-16-13(18-7)8(2)17-11-4-3-9(12(15)19)5-10(11)14/h3-6,8,17H,1-2H3,(H2,15,19) |
| InChIKey | NYANEQGBILKYJE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|