C13H12N4O4 — CID 106388770
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine (PubChem CID 106388770) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106388770 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine |
| SMILES | Cc1cnc(C(C)Nc2nc3cc([N+](=O)[O-])ccc3o2)o1 |
| InChI | InChI=1S/C13H12N4O4/c1-7-6-14-12(20-7)8(2)15-13-16-10-5-9(17(18)19)3-4-11(10)21-13/h3-6,8H,1-2H3,(H,15,16) |
| InChIKey | MXZWWQNVMFYGEF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|