C14H13Cl2N3O — CID 106389175
2-[1-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-5-methyl-1,3-oxazole (PubChem CID 106389175) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-[1-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-[1-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 106389175 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[1-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(C(C)n2c(CCl)nc3ccc(Cl)cc32)o1 |
| InChI | InChI=1S/C14H13Cl2N3O/c1-8-7-17-14(20-8)9(2)19-12-5-10(16)3-4-11(12)18-13(19)6-15/h3-5,7,9H,6H2,1-2H3 |
| InChIKey | YSUYYYZCDDKZRV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|