C10H12N4O2 — CID 106391158
N'-(cyanomethyl)-N-(2-pyrrol-1-ylethyl)oxamide (PubChem CID 106391158) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N'-(cyanomethyl)-N-(2-pyrrol-1-ylethyl)oxamide.
| Compound Name | N'-(cyanomethyl)-N-(2-pyrrol-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 106391158 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N'-(cyanomethyl)-N-(2-pyrrol-1-ylethyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)NCCn1cccc1 |
| InChI | InChI=1S/C10H12N4O2/c11-3-4-12-9(15)10(16)13-5-8-14-6-1-2-7-14/h1-2,6-7H,4-5,8H2,(H,12,15)(H,13,16) |
| InChIKey | DZSXWGOOOZFBEP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|