C13H17N3O2 — CID 106392807
1-(2-ethoxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine (PubChem CID 106392807) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine.
| Compound Name | 1-(2-ethoxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106392807 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine |
| SMILES | CCOc1ccccc1C(C)NCc1ncon1 |
| InChI | InChI=1S/C13H17N3O2/c1-3-17-12-7-5-4-6-11(12)10(2)14-8-13-15-9-18-16-13/h4-7,9-10,14H,3,8H2,1-2H3 |
| InChIKey | QGHKNOKHCMXXJN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |