C11H12FN3O2 — CID 114183050
4-fluoro-2-[1-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]phenol (PubChem CID 114183050) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is 4-fluoro-2-[1-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]phenol.
| Compound Name | 4-fluoro-2-[1-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 114183050 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-fluoro-2-[1-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]phenol |
| SMILES | CC(NCc1ncon1)c1cc(F)ccc1O |
| InChI | InChI=1S/C11H12FN3O2/c1-7(13-5-11-14-6-17-15-11)9-4-8(12)2-3-10(9)16/h2-4,6-7,13,16H,5H2,1H3 |
| InChIKey | YPSYIGDZTGQEKU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|