C11H19N3O2 — CID 106394026
N-(1,2,4-oxadiazol-3-ylmethyl)-2-propyloxan-4-amine (PubChem CID 106394026) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-2-propyloxan-4-amine.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-propyloxan-4-amine |
|---|---|
| PubChem CID | 106394026 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-propyloxan-4-amine |
| SMILES | CCCC1CC(NCc2ncon2)CCO1 |
| InChI | InChI=1S/C11H19N3O2/c1-2-3-10-6-9(4-5-15-10)12-7-11-13-8-16-14-11/h8-10,12H,2-7H2,1H3 |
| InChIKey | AZYLMFNSKBDTBT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |