C10H19N3O — CID 106396000
2-methyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentan-1-amine (PubChem CID 106396000) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentan-1-amine.
| Compound Name | 2-methyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 106396000 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-methyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentan-1-amine |
| SMILES | CCCC(C)CNCCc1ncon1 |
| InChI | InChI=1S/C10H19N3O/c1-3-4-9(2)7-11-6-5-10-12-8-14-13-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | RYCJTCZIAPAUBF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|