C7H11N3O3 — CID 106401045
methyl 2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]acetate (PubChem CID 106401045) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl 2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]acetate.
| Compound Name | methyl 2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]acetate |
|---|---|
| PubChem CID | 106401045 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | methyl 2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]acetate |
| SMILES | COC(=O)CNCCc1ncon1 |
| InChI | InChI=1S/C7H11N3O3/c1-12-7(11)4-8-3-2-6-9-5-13-10-6/h5,8H,2-4H2,1H3 |
| InChIKey | JUMCRYQJKKTLTH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|