C7H12N4O2 — CID 106400586
3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanamide (PubChem CID 106400586) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanamide.
| Compound Name | 3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 106400586 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanamide |
| SMILES | NC(=O)CCNCCc1ncon1 |
| InChI | InChI=1S/C7H12N4O2/c8-6(12)1-3-9-4-2-7-10-5-13-11-7/h5,9H,1-4H2,(H2,8,12) |
| InChIKey | PIHBSNXSSIKSLH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|