C12H25NO3 — CID 106401321
N-(2-but-3-enoxyethyl)-2,2-diethoxyethanamine (PubChem CID 106401321) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2,2-diethoxyethanamine.
| Compound Name | N-(2-but-3-enoxyethyl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 106401321 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2,2-diethoxyethanamine |
| SMILES | C=CCCOCCNCC(OCC)OCC |
| InChI | InChI=1S/C12H25NO3/c1-4-7-9-14-10-8-13-11-12(15-5-2)16-6-3/h4,12-13H,1,5-11H2,2-3H3 |
| InChIKey | UWCGYSCSMIYLKG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|