C14H19F2NO2 — CID 106401574
2-(2-but-3-enoxyethylamino)-1-(3,4-difluorophenyl)ethanol (PubChem CID 106401574) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-(2-but-3-enoxyethylamino)-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-(2-but-3-enoxyethylamino)-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 106401574 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(2-but-3-enoxyethylamino)-1-(3,4-difluorophenyl)ethanol |
| SMILES | C=CCCOCCNCC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-2-3-7-19-8-6-17-10-14(18)11-4-5-12(15)13(16)9-11/h2,4-5,9,14,17-18H,1,3,6-8,10H2 |
| InChIKey | CPUBOONMRJXJQZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|