C14H19FN2O2 — CID 106401656
3-[(2-but-3-enoxyethylamino)methyl]-4-fluorobenzamide (PubChem CID 106401656) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-[(2-but-3-enoxyethylamino)methyl]-4-fluorobenzamide.
| Compound Name | 3-[(2-but-3-enoxyethylamino)methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 106401656 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-[(2-but-3-enoxyethylamino)methyl]-4-fluorobenzamide |
| SMILES | C=CCCOCCNCc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C14H19FN2O2/c1-2-3-7-19-8-6-17-10-12-9-11(14(16)18)4-5-13(12)15/h2,4-5,9,17H,1,3,6-8,10H2,(H2,16,18) |
| InChIKey | NYFLRMXSALJIJL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|